About pentyl 2-(aminomethyl)-4-methyl-1,3-thiazole-5-carboxylate
pentyl 2-(aminomethyl)-4-methyl-1,3-thiazole-5-carboxylate (PubChem CID 63627980) has the molecular formula C11H18N2O2S
and a molecular weight of 242.34 g/mol. Its IUPAC name is pentyl 2-(aminomethyl)-4-methyl-1,3-thiazole-5-carboxylate.
Molecular Properties
| Compound Name | pentyl 2-(aminomethyl)-4-methyl-1,3-thiazole-5-carboxylate |
| PubChem CID | 63627980 |
| Molecular Formula | C11H18N2O2S |
| Molecular Weight | 242.34 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | pentyl 2-(aminomethyl)-4-methyl-1,3-thiazole-5-carboxylate |
| SMILES | CCCCCOC(=O)c1sc(CN)nc1C |
| InChI | InChI=1S/C11H18N2O2S/c1-3-4-5-6-15-11(14)10-8(2)13-9(7-12)16-10/h3-7,12H2,1-2H3 |
| InChIKey | YZRKYRZBDAMCLL-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.34 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze pentyl 2-(aminomethyl)-4-methyl-1,3-thiazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentyl 2-(aminomethyl)-4-methyl-1,3-thiazole-5-carboxylate?
The IUPAC name of pentyl 2-(aminomethyl)-4-methyl-1,3-thiazole-5-carboxylate (CID 63627980) is pentyl 2-(aminomethyl)-4-methyl-1,3-thiazole-5-carboxylate.
What is the SMILES notation for pentyl 2-(aminomethyl)-4-methyl-1,3-thiazole-5-carboxylate?
The canonical SMILES for pentyl 2-(aminomethyl)-4-methyl-1,3-thiazole-5-carboxylate is CCCCCOC(=O)c1sc(CN)nc1C.
What is the InChIKey of pentyl 2-(aminomethyl)-4-methyl-1,3-thiazole-5-carboxylate?
The InChIKey is YZRKYRZBDAMCLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2O2S/c1-3-4-5-6-15-11(14)10-8(2)13-9(7-12)16-10/h3-7,12H2,1-2H3.
What are the key properties of pentyl 2-(aminomethyl)-4-methyl-1,3-thiazole-5-carboxylate?
pentyl 2-(aminomethyl)-4-methyl-1,3-thiazole-5-carboxylate has a molecular weight of 242.34 g/mol, XLogP of 2.26, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for pentyl 2-(aminomethyl)-4-methyl-1,3-thiazole-5-carboxylate is sourced from PubChem (CID 63627980), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).