C11H20N4O2S — CID 63628121
1-cyclopropyl-5-(3,3-diethoxypropylsulfanyl)tetrazole (PubChem CID 63628121) has the molecular formula C11H20N4O2S and a molecular weight of 272.37 g/mol. Its IUPAC name is 1-cyclopropyl-5-(3,3-diethoxypropylsulfanyl)tetrazole.
| Compound Name | 1-cyclopropyl-5-(3,3-diethoxypropylsulfanyl)tetrazole |
|---|---|
| PubChem CID | 63628121 |
| Molecular Formula | C11H20N4O2S |
| Molecular Weight | 272.37 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | 1-cyclopropyl-5-(3,3-diethoxypropylsulfanyl)tetrazole |
| SMILES | CCOC(CCSc1nnnn1C1CC1)OCC |
| InChI | InChI=1S/C11H20N4O2S/c1-3-16-10(17-4-2)7-8-18-11-12-13-14-15(11)9-5-6-9/h9-10H,3-8H2,1-2H3 |
| InChIKey | PHXWMSNZZQOBQX-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 62.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.37 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|