About 1-(3,3-diethoxypropyl)-N,N-diethylpyrrolidin-3-amine
1-(3,3-diethoxypropyl)-N,N-diethylpyrrolidin-3-amine (PubChem CID 63628433) has the molecular formula C15H32N2O2
and a molecular weight of 272.43 g/mol. Its IUPAC name is 1-(3,3-diethoxypropyl)-N,N-diethylpyrrolidin-3-amine.
Molecular Properties
| Compound Name | 1-(3,3-diethoxypropyl)-N,N-diethylpyrrolidin-3-amine |
| PubChem CID | 63628433 |
| Molecular Formula | C15H32N2O2 |
| Molecular Weight | 272.43 g/mol |
| Exact Mass | 272.25 |
| IUPAC Name | 1-(3,3-diethoxypropyl)-N,N-diethylpyrrolidin-3-amine |
| SMILES | CCOC(CCN1CCC(N(CC)CC)C1)OCC |
| InChI | InChI=1S/C15H32N2O2/c1-5-17(6-2)14-9-11-16(13-14)12-10-15(18-7-3)19-8-4/h14-15H,5-13H2,1-4H3 |
| InChIKey | IRZAEGZDJMIPML-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.43 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-(3,3-diethoxypropyl)-N,N-diethylpyrrolidin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,3-diethoxypropyl)-N,N-diethylpyrrolidin-3-amine?
The IUPAC name of 1-(3,3-diethoxypropyl)-N,N-diethylpyrrolidin-3-amine (CID 63628433) is 1-(3,3-diethoxypropyl)-N,N-diethylpyrrolidin-3-amine.
What is the SMILES notation for 1-(3,3-diethoxypropyl)-N,N-diethylpyrrolidin-3-amine?
The canonical SMILES for 1-(3,3-diethoxypropyl)-N,N-diethylpyrrolidin-3-amine is CCOC(CCN1CCC(N(CC)CC)C1)OCC.
What is the InChIKey of 1-(3,3-diethoxypropyl)-N,N-diethylpyrrolidin-3-amine?
The InChIKey is IRZAEGZDJMIPML-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H32N2O2/c1-5-17(6-2)14-9-11-16(13-14)12-10-15(18-7-3)19-8-4/h14-15H,5-13H2,1-4H3.
What are the key properties of 1-(3,3-diethoxypropyl)-N,N-diethylpyrrolidin-3-amine?
1-(3,3-diethoxypropyl)-N,N-diethylpyrrolidin-3-amine has a molecular weight of 272.43 g/mol, XLogP of 2.19, 10 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,3-diethoxypropyl)-N,N-diethylpyrrolidin-3-amine is sourced from PubChem (CID 63628433), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).