About 1-(3,3-diethoxypropyl)pyrrolidin-3-amine
1-(3,3-diethoxypropyl)pyrrolidin-3-amine (PubChem CID 63628606) has the molecular formula C11H24N2O2
and a molecular weight of 216.32 g/mol. Its IUPAC name is 1-(3,3-diethoxypropyl)pyrrolidin-3-amine.
Molecular Properties
| Compound Name | 1-(3,3-diethoxypropyl)pyrrolidin-3-amine |
| PubChem CID | 63628606 |
| Molecular Formula | C11H24N2O2 |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.18 |
| IUPAC Name | 1-(3,3-diethoxypropyl)pyrrolidin-3-amine |
| SMILES | CCOC(CCN1CCC(N)C1)OCC |
| InChI | InChI=1S/C11H24N2O2/c1-3-14-11(15-4-2)6-8-13-7-5-10(12)9-13/h10-11H,3-9,12H2,1-2H3 |
| InChIKey | OOIIDXJKAYINJD-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-(3,3-diethoxypropyl)pyrrolidin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,3-diethoxypropyl)pyrrolidin-3-amine?
The IUPAC name of 1-(3,3-diethoxypropyl)pyrrolidin-3-amine (CID 63628606) is 1-(3,3-diethoxypropyl)pyrrolidin-3-amine.
What is the SMILES notation for 1-(3,3-diethoxypropyl)pyrrolidin-3-amine?
The canonical SMILES for 1-(3,3-diethoxypropyl)pyrrolidin-3-amine is CCOC(CCN1CCC(N)C1)OCC.
What is the InChIKey of 1-(3,3-diethoxypropyl)pyrrolidin-3-amine?
The InChIKey is OOIIDXJKAYINJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H24N2O2/c1-3-14-11(15-4-2)6-8-13-7-5-10(12)9-13/h10-11H,3-9,12H2,1-2H3.
What are the key properties of 1-(3,3-diethoxypropyl)pyrrolidin-3-amine?
1-(3,3-diethoxypropyl)pyrrolidin-3-amine has a molecular weight of 216.32 g/mol, XLogP of 0.81, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,3-diethoxypropyl)pyrrolidin-3-amine is sourced from PubChem (CID 63628606), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).