About 1-(2,2-diethoxyethoxy)-3,5-difluorobenzene
1-(2,2-diethoxyethoxy)-3,5-difluorobenzene (PubChem CID 63628941) has the molecular formula C12H16F2O3
and a molecular weight of 246.25 g/mol. Its IUPAC name is 1-(2,2-diethoxyethoxy)-3,5-difluorobenzene.
Molecular Properties
| Compound Name | 1-(2,2-diethoxyethoxy)-3,5-difluorobenzene |
| PubChem CID | 63628941 |
| Molecular Formula | C12H16F2O3 |
| Molecular Weight | 246.25 g/mol |
| Exact Mass | 246.11 |
| IUPAC Name | 1-(2,2-diethoxyethoxy)-3,5-difluorobenzene |
| SMILES | CCOC(COc1cc(F)cc(F)c1)OCC |
| InChI | InChI=1S/C12H16F2O3/c1-3-15-12(16-4-2)8-17-11-6-9(13)5-10(14)7-11/h5-7,12H,3-4,8H2,1-2H3 |
| InChIKey | ZFPVFDXGZQMHJB-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.25 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-(2,2-diethoxyethoxy)-3,5-difluorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,2-diethoxyethoxy)-3,5-difluorobenzene?
The IUPAC name of 1-(2,2-diethoxyethoxy)-3,5-difluorobenzene (CID 63628941) is 1-(2,2-diethoxyethoxy)-3,5-difluorobenzene.
What is the SMILES notation for 1-(2,2-diethoxyethoxy)-3,5-difluorobenzene?
The canonical SMILES for 1-(2,2-diethoxyethoxy)-3,5-difluorobenzene is CCOC(COc1cc(F)cc(F)c1)OCC.
What is the InChIKey of 1-(2,2-diethoxyethoxy)-3,5-difluorobenzene?
The InChIKey is ZFPVFDXGZQMHJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16F2O3/c1-3-15-12(16-4-2)8-17-11-6-9(13)5-10(14)7-11/h5-7,12H,3-4,8H2,1-2H3.
What are the key properties of 1-(2,2-diethoxyethoxy)-3,5-difluorobenzene?
1-(2,2-diethoxyethoxy)-3,5-difluorobenzene has a molecular weight of 246.25 g/mol, XLogP of 2.74, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,2-diethoxyethoxy)-3,5-difluorobenzene is sourced from PubChem (CID 63628941), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).