C10H16N4O2 — CID 63628965
1-(3,3-diethoxypropyl)-1,2,4-triazole-3-carbonitrile (PubChem CID 63628965) has the molecular formula C10H16N4O2 and a molecular weight of 224.26 g/mol. Its IUPAC name is 1-(3,3-diethoxypropyl)-1,2,4-triazole-3-carbonitrile.
| Compound Name | 1-(3,3-diethoxypropyl)-1,2,4-triazole-3-carbonitrile |
|---|---|
| PubChem CID | 63628965 |
| Molecular Formula | C10H16N4O2 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | 1-(3,3-diethoxypropyl)-1,2,4-triazole-3-carbonitrile |
| SMILES | CCOC(CCn1cnc(C#N)n1)OCC |
| InChI | InChI=1S/C10H16N4O2/c1-3-15-10(16-4-2)5-6-14-8-12-9(7-11)13-14/h8,10H,3-6H2,1-2H3 |
| InChIKey | GTWFQMZUWUYQQY-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 72.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|