About propan-2-amine
propan-2-amine (PubChem CID 6363) has the molecular formula C3H9N
and a molecular weight of 59.11 g/mol. Its IUPAC name is propan-2-amine.
Molecular Properties
| Compound Name | propan-2-amine |
| PubChem CID | 6363 |
| Molecular Formula | C3H9N |
| Molecular Weight | 59.11 g/mol |
| Exact Mass | 59.07 |
| IUPAC Name | propan-2-amine |
| SMILES | CC(C)N |
| InChI | InChI=1S/C3H9N/c1-3(2)4/h3H,4H2,1-2H3 |
| InChIKey | JJWLVOIRVHMVIS-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 4 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 59.11 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze propan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-amine?
The IUPAC name of propan-2-amine (CID 6363) is propan-2-amine.
What is the SMILES notation for propan-2-amine?
The canonical SMILES for propan-2-amine is CC(C)N.
What is the InChIKey of propan-2-amine?
The InChIKey is JJWLVOIRVHMVIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H9N/c1-3(2)4/h3H,4H2,1-2H3.
What are the key properties of propan-2-amine?
propan-2-amine has a molecular weight of 59.11 g/mol, XLogP of 0.35, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-amine is sourced from PubChem (CID 6363), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).