About ethyl 2-(6-bromo-2-hydroxy-3,4-dihydro-1H-naphthalen-2-yl)-2,2-difluoroacetate
ethyl 2-(6-bromo-2-hydroxy-3,4-dihydro-1H-naphthalen-2-yl)-2,2-difluoroacetate (PubChem CID 63630828) has the molecular formula C14H15BrF2O3
and a molecular weight of 349.17 g/mol. Its IUPAC name is ethyl 2-(6-bromo-2-hydroxy-3,4-dihydro-1H-naphthalen-2-yl)-2,2-difluoroacetate.
Molecular Properties
| Compound Name | ethyl 2-(6-bromo-2-hydroxy-3,4-dihydro-1H-naphthalen-2-yl)-2,2-difluoroacetate |
| PubChem CID | 63630828 |
| Molecular Formula | C14H15BrF2O3 |
| Molecular Weight | 349.17 g/mol |
| Exact Mass | 348.02 |
| IUPAC Name | ethyl 2-(6-bromo-2-hydroxy-3,4-dihydro-1H-naphthalen-2-yl)-2,2-difluoroacetate |
| SMILES | CCOC(=O)C(F)(F)C1(O)CCc2cc(Br)ccc2C1 |
| InChI | InChI=1S/C14H15BrF2O3/c1-2-20-12(18)14(16,17)13(19)6-5-9-7-11(15)4-3-10(9)8-13/h3-4,7,19H,2,5-6,8H2,1H3 |
| InChIKey | ARIFYUHIQULSKI-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.17 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl 2-(6-bromo-2-hydroxy-3,4-dihydro-1H-naphthalen-2-yl)-2,2-difluoroacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-(6-bromo-2-hydroxy-3,4-dihydro-1H-naphthalen-2-yl)-2,2-difluoroacetate?
The IUPAC name of ethyl 2-(6-bromo-2-hydroxy-3,4-dihydro-1H-naphthalen-2-yl)-2,2-difluoroacetate (CID 63630828) is ethyl 2-(6-bromo-2-hydroxy-3,4-dihydro-1H-naphthalen-2-yl)-2,2-difluoroacetate.
What is the SMILES notation for ethyl 2-(6-bromo-2-hydroxy-3,4-dihydro-1H-naphthalen-2-yl)-2,2-difluoroacetate?
The canonical SMILES for ethyl 2-(6-bromo-2-hydroxy-3,4-dihydro-1H-naphthalen-2-yl)-2,2-difluoroacetate is CCOC(=O)C(F)(F)C1(O)CCc2cc(Br)ccc2C1.
What is the InChIKey of ethyl 2-(6-bromo-2-hydroxy-3,4-dihydro-1H-naphthalen-2-yl)-2,2-difluoroacetate?
The InChIKey is ARIFYUHIQULSKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15BrF2O3/c1-2-20-12(18)14(16,17)13(19)6-5-9-7-11(15)4-3-10(9)8-13/h3-4,7,19H,2,5-6,8H2,1H3.
What are the key properties of ethyl 2-(6-bromo-2-hydroxy-3,4-dihydro-1H-naphthalen-2-yl)-2,2-difluoroacetate?
ethyl 2-(6-bromo-2-hydroxy-3,4-dihydro-1H-naphthalen-2-yl)-2,2-difluoroacetate has a molecular weight of 349.17 g/mol, XLogP of 2.87, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-(6-bromo-2-hydroxy-3,4-dihydro-1H-naphthalen-2-yl)-2,2-difluoroacetate is sourced from PubChem (CID 63630828), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).