About 6-bromo-2-methyl-3,4-dihydro-1H-naphthalen-2-ol
6-bromo-2-methyl-3,4-dihydro-1H-naphthalen-2-ol (PubChem CID 63632554) has the molecular formula C11H13BrO
and a molecular weight of 241.13 g/mol. Its IUPAC name is 6-bromo-2-methyl-3,4-dihydro-1H-naphthalen-2-ol.
Molecular Properties
| Compound Name | 6-bromo-2-methyl-3,4-dihydro-1H-naphthalen-2-ol |
| PubChem CID | 63632554 |
| Molecular Formula | C11H13BrO |
| Molecular Weight | 241.13 g/mol |
| Exact Mass | 240.01 |
| IUPAC Name | 6-bromo-2-methyl-3,4-dihydro-1H-naphthalen-2-ol |
| SMILES | CC1(O)CCc2cc(Br)ccc2C1 |
| InChI | InChI=1S/C11H13BrO/c1-11(13)5-4-8-6-10(12)3-2-9(8)7-11/h2-3,6,13H,4-5,7H2,1H3 |
| InChIKey | XVFPOIIFLDVICE-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.13 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-bromo-2-methyl-3,4-dihydro-1H-naphthalen-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-2-methyl-3,4-dihydro-1H-naphthalen-2-ol?
The IUPAC name of 6-bromo-2-methyl-3,4-dihydro-1H-naphthalen-2-ol (CID 63632554) is 6-bromo-2-methyl-3,4-dihydro-1H-naphthalen-2-ol.
What is the SMILES notation for 6-bromo-2-methyl-3,4-dihydro-1H-naphthalen-2-ol?
The canonical SMILES for 6-bromo-2-methyl-3,4-dihydro-1H-naphthalen-2-ol is CC1(O)CCc2cc(Br)ccc2C1.
What is the InChIKey of 6-bromo-2-methyl-3,4-dihydro-1H-naphthalen-2-ol?
The InChIKey is XVFPOIIFLDVICE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13BrO/c1-11(13)5-4-8-6-10(12)3-2-9(8)7-11/h2-3,6,13H,4-5,7H2,1H3.
What are the key properties of 6-bromo-2-methyl-3,4-dihydro-1H-naphthalen-2-ol?
6-bromo-2-methyl-3,4-dihydro-1H-naphthalen-2-ol has a molecular weight of 241.13 g/mol, XLogP of 2.69, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-2-methyl-3,4-dihydro-1H-naphthalen-2-ol is sourced from PubChem (CID 63632554), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).