About 6-bromo-2-propyl-3,4-dihydro-1H-naphthalen-2-ol
6-bromo-2-propyl-3,4-dihydro-1H-naphthalen-2-ol (PubChem CID 63632723) has the molecular formula C13H17BrO
and a molecular weight of 269.18 g/mol. Its IUPAC name is 6-bromo-2-propyl-3,4-dihydro-1H-naphthalen-2-ol.
Molecular Properties
| Compound Name | 6-bromo-2-propyl-3,4-dihydro-1H-naphthalen-2-ol |
| PubChem CID | 63632723 |
| Molecular Formula | C13H17BrO |
| Molecular Weight | 269.18 g/mol |
| Exact Mass | 268.05 |
| IUPAC Name | 6-bromo-2-propyl-3,4-dihydro-1H-naphthalen-2-ol |
| SMILES | CCCC1(O)CCc2cc(Br)ccc2C1 |
| InChI | InChI=1S/C13H17BrO/c1-2-6-13(15)7-5-10-8-12(14)4-3-11(10)9-13/h3-4,8,15H,2,5-7,9H2,1H3 |
| InChIKey | YSNAVVIHSKNUDM-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.18 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-bromo-2-propyl-3,4-dihydro-1H-naphthalen-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-2-propyl-3,4-dihydro-1H-naphthalen-2-ol?
The IUPAC name of 6-bromo-2-propyl-3,4-dihydro-1H-naphthalen-2-ol (CID 63632723) is 6-bromo-2-propyl-3,4-dihydro-1H-naphthalen-2-ol.
What is the SMILES notation for 6-bromo-2-propyl-3,4-dihydro-1H-naphthalen-2-ol?
The canonical SMILES for 6-bromo-2-propyl-3,4-dihydro-1H-naphthalen-2-ol is CCCC1(O)CCc2cc(Br)ccc2C1.
What is the InChIKey of 6-bromo-2-propyl-3,4-dihydro-1H-naphthalen-2-ol?
The InChIKey is YSNAVVIHSKNUDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17BrO/c1-2-6-13(15)7-5-10-8-12(14)4-3-11(10)9-13/h3-4,8,15H,2,5-7,9H2,1H3.
What are the key properties of 6-bromo-2-propyl-3,4-dihydro-1H-naphthalen-2-ol?
6-bromo-2-propyl-3,4-dihydro-1H-naphthalen-2-ol has a molecular weight of 269.18 g/mol, XLogP of 3.47, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-2-propyl-3,4-dihydro-1H-naphthalen-2-ol is sourced from PubChem (CID 63632723), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).