C16H24N2O — CID 63634001
2-(3-ethyl-4-methylpiperazin-1-yl)-2,3-dihydro-1H-inden-1-ol (PubChem CID 63634001) has the molecular formula C16H24N2O and a molecular weight of 260.38 g/mol. Its IUPAC name is 2-(3-ethyl-4-methylpiperazin-1-yl)-2,3-dihydro-1H-inden-1-ol.
| Compound Name | 2-(3-ethyl-4-methylpiperazin-1-yl)-2,3-dihydro-1H-inden-1-ol |
|---|---|
| PubChem CID | 63634001 |
| Molecular Formula | C16H24N2O |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.19 |
| IUPAC Name | 2-(3-ethyl-4-methylpiperazin-1-yl)-2,3-dihydro-1H-inden-1-ol |
| SMILES | CCC1CN(C2Cc3ccccc3C2O)CCN1C |
| InChI | InChI=1S/C16H24N2O/c1-3-13-11-18(9-8-17(13)2)15-10-12-6-4-5-7-14(12)16(15)19/h4-7,13,15-16,19H,3,8-11H2,1-2H3 |
| InChIKey | NTEGNHIEMRFVRC-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |