About 4-(2-fluorophenyl)sulfonyl-1,2,2-trimethylpiperazine
4-(2-fluorophenyl)sulfonyl-1,2,2-trimethylpiperazine (PubChem CID 63634158) has the molecular formula C13H19FN2O2S
and a molecular weight of 286.37 g/mol. Its IUPAC name is 4-(2-fluorophenyl)sulfonyl-1,2,2-trimethylpiperazine.
Molecular Properties
| Compound Name | 4-(2-fluorophenyl)sulfonyl-1,2,2-trimethylpiperazine |
| PubChem CID | 63634158 |
| Molecular Formula | C13H19FN2O2S |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | 4-(2-fluorophenyl)sulfonyl-1,2,2-trimethylpiperazine |
| SMILES | CN1CCN(S(=O)(=O)c2ccccc2F)CC1(C)C |
| InChI | InChI=1S/C13H19FN2O2S/c1-13(2)10-16(9-8-15(13)3)19(17,18)12-7-5-4-6-11(12)14/h4-7H,8-10H2,1-3H3 |
| InChIKey | AEXIHMSXYOPKLT-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(2-fluorophenyl)sulfonyl-1,2,2-trimethylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-fluorophenyl)sulfonyl-1,2,2-trimethylpiperazine?
The IUPAC name of 4-(2-fluorophenyl)sulfonyl-1,2,2-trimethylpiperazine (CID 63634158) is 4-(2-fluorophenyl)sulfonyl-1,2,2-trimethylpiperazine.
What is the SMILES notation for 4-(2-fluorophenyl)sulfonyl-1,2,2-trimethylpiperazine?
The canonical SMILES for 4-(2-fluorophenyl)sulfonyl-1,2,2-trimethylpiperazine is CN1CCN(S(=O)(=O)c2ccccc2F)CC1(C)C.
What is the InChIKey of 4-(2-fluorophenyl)sulfonyl-1,2,2-trimethylpiperazine?
The InChIKey is AEXIHMSXYOPKLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19FN2O2S/c1-13(2)10-16(9-8-15(13)3)19(17,18)12-7-5-4-6-11(12)14/h4-7H,8-10H2,1-3H3.
What are the key properties of 4-(2-fluorophenyl)sulfonyl-1,2,2-trimethylpiperazine?
4-(2-fluorophenyl)sulfonyl-1,2,2-trimethylpiperazine has a molecular weight of 286.37 g/mol, XLogP of 1.54, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-fluorophenyl)sulfonyl-1,2,2-trimethylpiperazine is sourced from PubChem (CID 63634158), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).