About 4-(4-chlorobutyl)-1,2-dimethylpiperazine
4-(4-chlorobutyl)-1,2-dimethylpiperazine (PubChem CID 63635546) has the molecular formula C10H21ClN2
and a molecular weight of 204.74 g/mol. Its IUPAC name is 4-(4-chlorobutyl)-1,2-dimethylpiperazine.
Molecular Properties
| Compound Name | 4-(4-chlorobutyl)-1,2-dimethylpiperazine |
| PubChem CID | 63635546 |
| Molecular Formula | C10H21ClN2 |
| Molecular Weight | 204.74 g/mol |
| Exact Mass | 204.14 |
| IUPAC Name | 4-(4-chlorobutyl)-1,2-dimethylpiperazine |
| SMILES | CC1CN(CCCCCl)CCN1C |
| InChI | InChI=1S/C10H21ClN2/c1-10-9-13(6-4-3-5-11)8-7-12(10)2/h10H,3-9H2,1-2H3 |
| InChIKey | IENYSGWHEKSNPA-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.74 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-chlorobutyl)-1,2-dimethylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-chlorobutyl)-1,2-dimethylpiperazine?
The IUPAC name of 4-(4-chlorobutyl)-1,2-dimethylpiperazine (CID 63635546) is 4-(4-chlorobutyl)-1,2-dimethylpiperazine.
What is the SMILES notation for 4-(4-chlorobutyl)-1,2-dimethylpiperazine?
The canonical SMILES for 4-(4-chlorobutyl)-1,2-dimethylpiperazine is CC1CN(CCCCCl)CCN1C.
What is the InChIKey of 4-(4-chlorobutyl)-1,2-dimethylpiperazine?
The InChIKey is IENYSGWHEKSNPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21ClN2/c1-10-9-13(6-4-3-5-11)8-7-12(10)2/h10H,3-9H2,1-2H3.
What are the key properties of 4-(4-chlorobutyl)-1,2-dimethylpiperazine?
4-(4-chlorobutyl)-1,2-dimethylpiperazine has a molecular weight of 204.74 g/mol, XLogP of 1.64, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-chlorobutyl)-1,2-dimethylpiperazine is sourced from PubChem (CID 63635546), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).