C14H29N3O — CID 63635835
1-[3-[(4-ethyl-3-methylpiperazin-1-yl)methyl]oxolan-3-yl]-N-methylmethanamine (PubChem CID 63635835) has the molecular formula C14H29N3O and a molecular weight of 255.41 g/mol. Its IUPAC name is 1-[3-[(4-ethyl-3-methylpiperazin-1-yl)methyl]oxolan-3-yl]-N-methylmethanamine.
| Compound Name | 1-[3-[(4-ethyl-3-methylpiperazin-1-yl)methyl]oxolan-3-yl]-N-methylmethanamine |
|---|---|
| PubChem CID | 63635835 |
| Molecular Formula | C14H29N3O |
| Molecular Weight | 255.41 g/mol |
| Exact Mass | 255.23 |
| IUPAC Name | 1-[3-[(4-ethyl-3-methylpiperazin-1-yl)methyl]oxolan-3-yl]-N-methylmethanamine |
| SMILES | CCN1CCN(CC2(CNC)CCOC2)CC1C |
| InChI | InChI=1S/C14H29N3O/c1-4-17-7-6-16(9-13(17)2)11-14(10-15-3)5-8-18-12-14/h13,15H,4-12H2,1-3H3 |
| InChIKey | YQDPBJCDNODZLW-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.41 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |