About 2-[1-(1,1-dioxothiolan-3-yl)benzimidazol-2-yl]ethanethioamide
2-[1-(1,1-dioxothiolan-3-yl)benzimidazol-2-yl]ethanethioamide (PubChem CID 63636877) has the molecular formula C13H15N3O2S2
and a molecular weight of 309.42 g/mol. Its IUPAC name is 2-[1-(1,1-dioxothiolan-3-yl)benzimidazol-2-yl]ethanethioamide.
Molecular Properties
| Compound Name | 2-[1-(1,1-dioxothiolan-3-yl)benzimidazol-2-yl]ethanethioamide |
| PubChem CID | 63636877 |
| Molecular Formula | C13H15N3O2S2 |
| Molecular Weight | 309.42 g/mol |
| Exact Mass | 309.06 |
| IUPAC Name | 2-[1-(1,1-dioxothiolan-3-yl)benzimidazol-2-yl]ethanethioamide |
| SMILES | NC(=S)Cc1nc2ccccc2n1C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H15N3O2S2/c14-12(19)7-13-15-10-3-1-2-4-11(10)16(13)9-5-6-20(17,18)8-9/h1-4,9H,5-8H2,(H2,14,19) |
| InChIKey | CIDWKUZISMBCBN-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 77.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.42 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-[1-(1,1-dioxothiolan-3-yl)benzimidazol-2-yl]ethanethioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-(1,1-dioxothiolan-3-yl)benzimidazol-2-yl]ethanethioamide?
The IUPAC name of 2-[1-(1,1-dioxothiolan-3-yl)benzimidazol-2-yl]ethanethioamide (CID 63636877) is 2-[1-(1,1-dioxothiolan-3-yl)benzimidazol-2-yl]ethanethioamide.
What is the SMILES notation for 2-[1-(1,1-dioxothiolan-3-yl)benzimidazol-2-yl]ethanethioamide?
The canonical SMILES for 2-[1-(1,1-dioxothiolan-3-yl)benzimidazol-2-yl]ethanethioamide is NC(=S)Cc1nc2ccccc2n1C1CCS(=O)(=O)C1.
What is the InChIKey of 2-[1-(1,1-dioxothiolan-3-yl)benzimidazol-2-yl]ethanethioamide?
The InChIKey is CIDWKUZISMBCBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15N3O2S2/c14-12(19)7-13-15-10-3-1-2-4-11(10)16(13)9-5-6-20(17,18)8-9/h1-4,9H,5-8H2,(H2,14,19).
What are the key properties of 2-[1-(1,1-dioxothiolan-3-yl)benzimidazol-2-yl]ethanethioamide?
2-[1-(1,1-dioxothiolan-3-yl)benzimidazol-2-yl]ethanethioamide has a molecular weight of 309.42 g/mol, XLogP of 1.22, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-(1,1-dioxothiolan-3-yl)benzimidazol-2-yl]ethanethioamide is sourced from PubChem (CID 63636877), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).