C15H19N5O — CID 63637029
5-[3-(1H-benzimidazol-2-ylmethyl)-1,2,4-oxadiazol-5-yl]pentan-1-amine (PubChem CID 63637029) has the molecular formula C15H19N5O and a molecular weight of 285.35 g/mol. Its IUPAC name is 5-[3-(1H-benzimidazol-2-ylmethyl)-1,2,4-oxadiazol-5-yl]pentan-1-amine.
| Compound Name | 5-[3-(1H-benzimidazol-2-ylmethyl)-1,2,4-oxadiazol-5-yl]pentan-1-amine |
|---|---|
| PubChem CID | 63637029 |
| Molecular Formula | C15H19N5O |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.16 |
| IUPAC Name | 5-[3-(1H-benzimidazol-2-ylmethyl)-1,2,4-oxadiazol-5-yl]pentan-1-amine |
| SMILES | NCCCCCc1nc(Cc2nc3ccccc3[nH]2)no1 |
| InChI | InChI=1S/C15H19N5O/c16-9-5-1-2-8-15-19-14(20-21-15)10-13-17-11-6-3-4-7-12(11)18-13/h3-4,6-7H,1-2,5,8-10,16H2,(H,17,18) |
| InChIKey | ACIQRKRYXFCOBW-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 93.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|