About 3-[[methyl(2,2,2-trifluoroethyl)amino]methyl]thiophene-2-carboxylic acid
3-[[methyl(2,2,2-trifluoroethyl)amino]methyl]thiophene-2-carboxylic acid (PubChem CID 63639380) has the molecular formula C9H10F3NO2S
and a molecular weight of 253.24 g/mol. Its IUPAC name is 3-[[methyl(2,2,2-trifluoroethyl)amino]methyl]thiophene-2-carboxylic acid.
Molecular Properties
| Compound Name | 3-[[methyl(2,2,2-trifluoroethyl)amino]methyl]thiophene-2-carboxylic acid |
| PubChem CID | 63639380 |
| Molecular Formula | C9H10F3NO2S |
| Molecular Weight | 253.24 g/mol |
| Exact Mass | 253.04 |
| IUPAC Name | 3-[[methyl(2,2,2-trifluoroethyl)amino]methyl]thiophene-2-carboxylic acid |
| SMILES | CN(Cc1ccsc1C(=O)O)CC(F)(F)F |
| InChI | InChI=1S/C9H10F3NO2S/c1-13(5-9(10,11)12)4-6-2-3-16-7(6)8(14)15/h2-3H,4-5H2,1H3,(H,14,15) |
| InChIKey | YPNQDAPSJMXIQM-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.24 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[[methyl(2,2,2-trifluoroethyl)amino]methyl]thiophene-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[methyl(2,2,2-trifluoroethyl)amino]methyl]thiophene-2-carboxylic acid?
The IUPAC name of 3-[[methyl(2,2,2-trifluoroethyl)amino]methyl]thiophene-2-carboxylic acid (CID 63639380) is 3-[[methyl(2,2,2-trifluoroethyl)amino]methyl]thiophene-2-carboxylic acid.
What is the SMILES notation for 3-[[methyl(2,2,2-trifluoroethyl)amino]methyl]thiophene-2-carboxylic acid?
The canonical SMILES for 3-[[methyl(2,2,2-trifluoroethyl)amino]methyl]thiophene-2-carboxylic acid is CN(Cc1ccsc1C(=O)O)CC(F)(F)F.
What is the InChIKey of 3-[[methyl(2,2,2-trifluoroethyl)amino]methyl]thiophene-2-carboxylic acid?
The InChIKey is YPNQDAPSJMXIQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10F3NO2S/c1-13(5-9(10,11)12)4-6-2-3-16-7(6)8(14)15/h2-3H,4-5H2,1H3,(H,14,15).
What are the key properties of 3-[[methyl(2,2,2-trifluoroethyl)amino]methyl]thiophene-2-carboxylic acid?
3-[[methyl(2,2,2-trifluoroethyl)amino]methyl]thiophene-2-carboxylic acid has a molecular weight of 253.24 g/mol, XLogP of 2.44, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[methyl(2,2,2-trifluoroethyl)amino]methyl]thiophene-2-carboxylic acid is sourced from PubChem (CID 63639380), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).