C13H21NO2 — CID 63640120
1-[2-(2-methoxyethoxy)-4-methylphenyl]-N-methylethanamine (PubChem CID 63640120) has the molecular formula C13H21NO2 and a molecular weight of 223.32 g/mol. Its IUPAC name is 1-[2-(2-methoxyethoxy)-4-methylphenyl]-N-methylethanamine.
| Compound Name | 1-[2-(2-methoxyethoxy)-4-methylphenyl]-N-methylethanamine |
|---|---|
| PubChem CID | 63640120 |
| Molecular Formula | C13H21NO2 |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.16 |
| IUPAC Name | 1-[2-(2-methoxyethoxy)-4-methylphenyl]-N-methylethanamine |
| SMILES | CNC(C)c1ccc(C)cc1OCCOC |
| InChI | InChI=1S/C13H21NO2/c1-10-5-6-12(11(2)14-3)13(9-10)16-8-7-15-4/h5-6,9,11,14H,7-8H2,1-4H3 |
| InChIKey | OJOVTCGBBFPGMV-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|