C13H13N5 — CID 63641541
3-[2-(cyanomethyl)benzimidazol-1-yl]-2-(methylamino)propanenitrile (PubChem CID 63641541) has the molecular formula C13H13N5 and a molecular weight of 239.28 g/mol. Its IUPAC name is 3-[2-(cyanomethyl)benzimidazol-1-yl]-2-(methylamino)propanenitrile.
| Compound Name | 3-[2-(cyanomethyl)benzimidazol-1-yl]-2-(methylamino)propanenitrile |
|---|---|
| PubChem CID | 63641541 |
| Molecular Formula | C13H13N5 |
| Molecular Weight | 239.28 g/mol |
| Exact Mass | 239.12 |
| IUPAC Name | 3-[2-(cyanomethyl)benzimidazol-1-yl]-2-(methylamino)propanenitrile |
| SMILES | CNC(C#N)Cn1c(CC#N)nc2ccccc21 |
| InChI | InChI=1S/C13H13N5/c1-16-10(8-15)9-18-12-5-3-2-4-11(12)17-13(18)6-7-14/h2-5,10,16H,6,9H2,1H3 |
| InChIKey | OKDXYGUWRPVMFU-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 77.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.28 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |