About 6-[(2-oxo-1,3-dihydroimidazole-4-carbonyl)amino]pyridine-2-carboxylic acid
6-[(2-oxo-1,3-dihydroimidazole-4-carbonyl)amino]pyridine-2-carboxylic acid (PubChem CID 63642570) has the molecular formula C10H8N4O4
and a molecular weight of 248.20 g/mol. Its IUPAC name is 6-[(2-oxo-1,3-dihydroimidazole-4-carbonyl)amino]pyridine-2-carboxylic acid.
Molecular Properties
| Compound Name | 6-[(2-oxo-1,3-dihydroimidazole-4-carbonyl)amino]pyridine-2-carboxylic acid |
| PubChem CID | 63642570 |
| Molecular Formula | C10H8N4O4 |
| Molecular Weight | 248.20 g/mol |
| Exact Mass | 248.05 |
| IUPAC Name | 6-[(2-oxo-1,3-dihydroimidazole-4-carbonyl)amino]pyridine-2-carboxylic acid |
| SMILES | O=C(O)c1cccc(NC(=O)c2c[nH]c(=O)[nH]2)n1 |
| InChI | InChI=1S/C10H8N4O4/c15-8(6-4-11-10(18)13-6)14-7-3-1-2-5(12-7)9(16)17/h1-4H,(H,16,17)(H2,11,13,18)(H,12,14,15) |
| InChIKey | CGSHJWJINRCSSI-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 127.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.20 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-[(2-oxo-1,3-dihydroimidazole-4-carbonyl)amino]pyridine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(2-oxo-1,3-dihydroimidazole-4-carbonyl)amino]pyridine-2-carboxylic acid?
The IUPAC name of 6-[(2-oxo-1,3-dihydroimidazole-4-carbonyl)amino]pyridine-2-carboxylic acid (CID 63642570) is 6-[(2-oxo-1,3-dihydroimidazole-4-carbonyl)amino]pyridine-2-carboxylic acid.
What is the SMILES notation for 6-[(2-oxo-1,3-dihydroimidazole-4-carbonyl)amino]pyridine-2-carboxylic acid?
The canonical SMILES for 6-[(2-oxo-1,3-dihydroimidazole-4-carbonyl)amino]pyridine-2-carboxylic acid is O=C(O)c1cccc(NC(=O)c2c[nH]c(=O)[nH]2)n1.
What is the InChIKey of 6-[(2-oxo-1,3-dihydroimidazole-4-carbonyl)amino]pyridine-2-carboxylic acid?
The InChIKey is CGSHJWJINRCSSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N4O4/c15-8(6-4-11-10(18)13-6)14-7-3-1-2-5(12-7)9(16)17/h1-4H,(H,16,17)(H2,11,13,18)(H,12,14,15).
What are the key properties of 6-[(2-oxo-1,3-dihydroimidazole-4-carbonyl)amino]pyridine-2-carboxylic acid?
6-[(2-oxo-1,3-dihydroimidazole-4-carbonyl)amino]pyridine-2-carboxylic acid has a molecular weight of 248.20 g/mol, XLogP of 0.05, 3 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(2-oxo-1,3-dihydroimidazole-4-carbonyl)amino]pyridine-2-carboxylic acid is sourced from PubChem (CID 63642570), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).