C15H28N2O2 — CID 63642751
N-(1,4-dioxaspiro[4.5]decan-8-yl)-N-ethylpiperidin-3-amine (PubChem CID 63642751) has the molecular formula C15H28N2O2 and a molecular weight of 268.40 g/mol. Its IUPAC name is N-(1,4-dioxaspiro[4.5]decan-8-yl)-N-ethylpiperidin-3-amine.
| Compound Name | N-(1,4-dioxaspiro[4.5]decan-8-yl)-N-ethylpiperidin-3-amine |
|---|---|
| PubChem CID | 63642751 |
| Molecular Formula | C15H28N2O2 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.22 |
| IUPAC Name | N-(1,4-dioxaspiro[4.5]decan-8-yl)-N-ethylpiperidin-3-amine |
| SMILES | CCN(C1CCC2(CC1)OCCO2)C1CCCNC1 |
| InChI | InChI=1S/C15H28N2O2/c1-2-17(14-4-3-9-16-12-14)13-5-7-15(8-6-13)18-10-11-19-15/h13-14,16H,2-12H2,1H3 |
| InChIKey | CBKGVAQZEKFPFE-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |