C15H24O — CID 636436
[(1S,2S,5R,8R,9S)-2,5,9-trimethyl-3-tricyclo[6.3.0.01,5]undec-3-enyl]methanol (PubChem CID 636436) has the molecular formula C15H24O and a molecular weight of 220.36 g/mol. Its IUPAC name is [(1S,2S,5R,8R,9S)-2,5,9-trimethyl-3-tricyclo[6.3.0.01,5]undec-3-enyl]methanol.
| Compound Name | [(1S,2S,5R,8R,9S)-2,5,9-trimethyl-3-tricyclo[6.3.0.01,5]undec-3-enyl]methanol |
|---|---|
| PubChem CID | 636436 |
| Molecular Formula | C15H24O |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.18 |
| IUPAC Name | [(1S,2S,5R,8R,9S)-2,5,9-trimethyl-3-tricyclo[6.3.0.01,5]undec-3-enyl]methanol |
| SMILES | C[C@@H]1C(CO)=C[C@@]2(C)CC[C@@H]3[C@@H](C)CC[C@@]132 |
| InChI | InChI=1S/C15H24O/c1-10-4-7-15-11(2)12(9-16)8-14(15,3)6-5-13(10)15/h8,10-11,13,16H,4-7,9H2,1-3H3/t10-,11+,13+,14+,15+/m0/s1 |
| InChIKey | GJNXTRPTZOVADS-PWRGDLIESA-N |
| XLogP | 3.39 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|