C17H26N2O — CID 63644211
1,7-dimethyl-3-[methyl(piperidin-3-yl)amino]-2,3-dihydro-1H-inden-4-ol (PubChem CID 63644211) has the molecular formula C17H26N2O and a molecular weight of 274.41 g/mol. Its IUPAC name is 1,7-dimethyl-3-[methyl(piperidin-3-yl)amino]-2,3-dihydro-1H-inden-4-ol.
| Compound Name | 1,7-dimethyl-3-[methyl(piperidin-3-yl)amino]-2,3-dihydro-1H-inden-4-ol |
|---|---|
| PubChem CID | 63644211 |
| Molecular Formula | C17H26N2O |
| Molecular Weight | 274.41 g/mol |
| Exact Mass | 274.20 |
| IUPAC Name | 1,7-dimethyl-3-[methyl(piperidin-3-yl)amino]-2,3-dihydro-1H-inden-4-ol |
| SMILES | Cc1ccc(O)c2c1C(C)CC2N(C)C1CCCNC1 |
| InChI | InChI=1S/C17H26N2O/c1-11-6-7-15(20)17-14(9-12(2)16(11)17)19(3)13-5-4-8-18-10-13/h6-7,12-14,18,20H,4-5,8-10H2,1-3H3 |
| InChIKey | KNLWTKAIBLTBDY-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.41 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|