C20H22O7 — CID 636452
(1S,3S,5S,5'S,6R,7R,9R,10R)-5'-(furan-3-yl)-3-hydroxy-7-methylspiro[12,14-dioxatetracyclo[7.4.1.01,10.05,10]tetradecane-6,3'-oxolane]-2',13-dione (PubChem CID 636452) has the molecular formula C20H22O7 and a molecular weight of 374.39 g/mol. Its IUPAC name is (1S,3S,5S,5'S,6R,7R,9R,10R)-5'-(furan-3-yl)-3-hydroxy-7-methylspiro[12,14-dioxatetracyclo[7.4.1.01,10.05,10]tetradecane-6,3'-oxolane]-2',13-dione.
| Compound Name | (1S,3S,5S,5'S,6R,7R,9R,10R)-5'-(furan-3-yl)-3-hydroxy-7-methylspiro[12,14-dioxatetracyclo[7.4.1.01,10.05,10]tetradecane-6,3'-oxolane]-2',13-dione |
|---|---|
| PubChem CID | 636452 |
| Molecular Formula | C20H22O7 |
| Molecular Weight | 374.39 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | (1S,3S,5S,5'S,6R,7R,9R,10R)-5'-(furan-3-yl)-3-hydroxy-7-methylspiro[12,14-dioxatetracyclo[7.4.1.01,10.05,10]tetradecane-6,3'-oxolane]-2',13-dione |
| SMILES | C[C@@H]1C[C@H]2O[C@@]34C[C@@H](O)C[C@H]([C@@]15C[C@@H](c1ccoc1)OC5=O)[C@@]23COC4=O |
| InChI | InChI=1S/C20H22O7/c1-10-4-15-19-9-25-17(23)20(19,27-15)6-12(21)5-14(19)18(10)7-13(26-16(18)22)11-2-3-24-8-11/h2-3,8,10,12-15,21H,4-7,9H2,1H3/t10-,12+,13+,14-,15-,18-,19+,20-/m1/s1 |
| InChIKey | NSCSTGLJZSMRIY-RWZNVSPQSA-N |
| XLogP | 1.75 |
| TPSA | 95.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.39 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |