About [1,2,4]triazolo[1,5-a]pyrimidine
[1,2,4]triazolo[1,5-a]pyrimidine (PubChem CID 636456) has the molecular formula C5H4N4
and a molecular weight of 120.11 g/mol. Its IUPAC name is [1,2,4]triazolo[1,5-a]pyrimidine.
Molecular Properties
| Compound Name | [1,2,4]triazolo[1,5-a]pyrimidine |
| PubChem CID | 636456 |
| Molecular Formula | C5H4N4 |
| Molecular Weight | 120.11 g/mol |
| Exact Mass | 120.04 |
| IUPAC Name | [1,2,4]triazolo[1,5-a]pyrimidine |
| SMILES | c1cnc2ncnn2c1 |
| InChI | InChI=1S/C5H4N4/c1-2-6-5-7-4-8-9(5)3-1/h1-4H |
| InChIKey | SRNKZYRMFBGSGE-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 120.11 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [1,2,4]triazolo[1,5-a]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1,2,4]triazolo[1,5-a]pyrimidine?
The IUPAC name of [1,2,4]triazolo[1,5-a]pyrimidine (CID 636456) is [1,2,4]triazolo[1,5-a]pyrimidine.
What is the SMILES notation for [1,2,4]triazolo[1,5-a]pyrimidine?
The canonical SMILES for [1,2,4]triazolo[1,5-a]pyrimidine is c1cnc2ncnn2c1.
What is the InChIKey of [1,2,4]triazolo[1,5-a]pyrimidine?
The InChIKey is SRNKZYRMFBGSGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4N4/c1-2-6-5-7-4-8-9(5)3-1/h1-4H.
What are the key properties of [1,2,4]triazolo[1,5-a]pyrimidine?
[1,2,4]triazolo[1,5-a]pyrimidine has a molecular weight of 120.11 g/mol, XLogP of 0.12, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1,2,4]triazolo[1,5-a]pyrimidine is sourced from PubChem (CID 636456), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).