About 5-hydroxy-2,2-dimethyl-8H-furo[3,4-g]chromen-6-one
5-hydroxy-2,2-dimethyl-8H-furo[3,4-g]chromen-6-one (PubChem CID 636462) has the molecular formula C13H12O4
and a molecular weight of 232.23 g/mol. Its IUPAC name is 5-hydroxy-2,2-dimethyl-8H-furo[3,4-g]chromen-6-one.
Molecular Properties
| Compound Name | 5-hydroxy-2,2-dimethyl-8H-furo[3,4-g]chromen-6-one |
| PubChem CID | 636462 |
| Molecular Formula | C13H12O4 |
| Molecular Weight | 232.23 g/mol |
| Exact Mass | 232.07 |
| IUPAC Name | 5-hydroxy-2,2-dimethyl-8H-furo[3,4-g]chromen-6-one |
| SMILES | CC1(C)C=Cc2c(cc3c(c2O)C(=O)OC3)O1 |
| InChI | InChI=1S/C13H12O4/c1-13(2)4-3-8-9(17-13)5-7-6-16-12(15)10(7)11(8)14/h3-5,14H,6H2,1-2H3 |
| InChIKey | ZYOUEEMPKPNVQW-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.23 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-hydroxy-2,2-dimethyl-8H-furo[3,4-g]chromen-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-hydroxy-2,2-dimethyl-8H-furo[3,4-g]chromen-6-one?
The IUPAC name of 5-hydroxy-2,2-dimethyl-8H-furo[3,4-g]chromen-6-one (CID 636462) is 5-hydroxy-2,2-dimethyl-8H-furo[3,4-g]chromen-6-one.
What is the SMILES notation for 5-hydroxy-2,2-dimethyl-8H-furo[3,4-g]chromen-6-one?
The canonical SMILES for 5-hydroxy-2,2-dimethyl-8H-furo[3,4-g]chromen-6-one is CC1(C)C=Cc2c(cc3c(c2O)C(=O)OC3)O1.
What is the InChIKey of 5-hydroxy-2,2-dimethyl-8H-furo[3,4-g]chromen-6-one?
The InChIKey is ZYOUEEMPKPNVQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12O4/c1-13(2)4-3-8-9(17-13)5-7-6-16-12(15)10(7)11(8)14/h3-5,14H,6H2,1-2H3.
What are the key properties of 5-hydroxy-2,2-dimethyl-8H-furo[3,4-g]chromen-6-one?
5-hydroxy-2,2-dimethyl-8H-furo[3,4-g]chromen-6-one has a molecular weight of 232.23 g/mol, XLogP of 2.25, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-hydroxy-2,2-dimethyl-8H-furo[3,4-g]chromen-6-one is sourced from PubChem (CID 636462), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).