C14H26O — CID 6364638
(5E)-2,6,10-trimethylundeca-5,9-dien-1-ol (PubChem CID 6364638) has the molecular formula C14H26O and a molecular weight of 210.36 g/mol. Its IUPAC name is (5E)-2,6,10-trimethylundeca-5,9-dien-1-ol.
| Compound Name | (5E)-2,6,10-trimethylundeca-5,9-dien-1-ol |
|---|---|
| PubChem CID | 6364638 |
| Molecular Formula | C14H26O |
| Molecular Weight | 210.36 g/mol |
| Exact Mass | 210.20 |
| IUPAC Name | (5E)-2,6,10-trimethylundeca-5,9-dien-1-ol |
| SMILES | CC(C)=CCC/C(C)=C/CCC(C)CO |
| InChI | InChI=1S/C14H26O/c1-12(2)7-5-8-13(3)9-6-10-14(4)11-15/h7,9,14-15H,5-6,8,10-11H2,1-4H3/b13-9+ |
| InChIKey | SVHDKVPXRARVAO-UKTHLTGXSA-N |
| XLogP | 4.09 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.36 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|