About 3-[chloro-(3-fluoro-4-methylphenyl)methyl]thiolane 1,1-dioxide
3-[chloro-(3-fluoro-4-methylphenyl)methyl]thiolane 1,1-dioxide (PubChem CID 63647028) has the molecular formula C12H14ClFO2S
and a molecular weight of 276.76 g/mol. Its IUPAC name is 3-[chloro-(3-fluoro-4-methylphenyl)methyl]thiolane 1,1-dioxide.
Molecular Properties
| Compound Name | 3-[chloro-(3-fluoro-4-methylphenyl)methyl]thiolane 1,1-dioxide |
| PubChem CID | 63647028 |
| Molecular Formula | C12H14ClFO2S |
| Molecular Weight | 276.76 g/mol |
| Exact Mass | 276.04 |
| IUPAC Name | 3-[chloro-(3-fluoro-4-methylphenyl)methyl]thiolane 1,1-dioxide |
| SMILES | Cc1ccc(C(Cl)C2CCS(=O)(=O)C2)cc1F |
| InChI | InChI=1S/C12H14ClFO2S/c1-8-2-3-9(6-11(8)14)12(13)10-4-5-17(15,16)7-10/h2-3,6,10,12H,4-5,7H2,1H3 |
| InChIKey | WPXYCYKPEFUNFS-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.76 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-[chloro-(3-fluoro-4-methylphenyl)methyl]thiolane 1,1-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[chloro-(3-fluoro-4-methylphenyl)methyl]thiolane 1,1-dioxide?
The IUPAC name of 3-[chloro-(3-fluoro-4-methylphenyl)methyl]thiolane 1,1-dioxide (CID 63647028) is 3-[chloro-(3-fluoro-4-methylphenyl)methyl]thiolane 1,1-dioxide.
What is the SMILES notation for 3-[chloro-(3-fluoro-4-methylphenyl)methyl]thiolane 1,1-dioxide?
The canonical SMILES for 3-[chloro-(3-fluoro-4-methylphenyl)methyl]thiolane 1,1-dioxide is Cc1ccc(C(Cl)C2CCS(=O)(=O)C2)cc1F.
What is the InChIKey of 3-[chloro-(3-fluoro-4-methylphenyl)methyl]thiolane 1,1-dioxide?
The InChIKey is WPXYCYKPEFUNFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14ClFO2S/c1-8-2-3-9(6-11(8)14)12(13)10-4-5-17(15,16)7-10/h2-3,6,10,12H,4-5,7H2,1H3.
What are the key properties of 3-[chloro-(3-fluoro-4-methylphenyl)methyl]thiolane 1,1-dioxide?
3-[chloro-(3-fluoro-4-methylphenyl)methyl]thiolane 1,1-dioxide has a molecular weight of 276.76 g/mol, XLogP of 2.85, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[chloro-(3-fluoro-4-methylphenyl)methyl]thiolane 1,1-dioxide is sourced from PubChem (CID 63647028), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).