C13H11F2NOS — CID 63649307
3,5-difluoro-4-(4-methylsulfanylphenoxy)aniline (PubChem CID 63649307) has the molecular formula C13H11F2NOS and a molecular weight of 267.30 g/mol. Its IUPAC name is 3,5-difluoro-4-(4-methylsulfanylphenoxy)aniline.
| Compound Name | 3,5-difluoro-4-(4-methylsulfanylphenoxy)aniline |
|---|---|
| PubChem CID | 63649307 |
| Molecular Formula | C13H11F2NOS |
| Molecular Weight | 267.30 g/mol |
| Exact Mass | 267.05 |
| IUPAC Name | 3,5-difluoro-4-(4-methylsulfanylphenoxy)aniline |
| SMILES | CSc1ccc(Oc2c(F)cc(N)cc2F)cc1 |
| InChI | InChI=1S/C13H11F2NOS/c1-18-10-4-2-9(3-5-10)17-13-11(14)6-8(16)7-12(13)15/h2-7H,16H2,1H3 |
| InChIKey | HDZCGIIYQAKTOD-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.30 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|