C20H15N3O3S4 — CID 6364950
4-[(5E)-5-[(4-methylphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(1,3-thiazol-2-yl)benzenesulfonamide (PubChem CID 6364950) has the molecular formula C20H15N3O3S4 and a molecular weight of 473.63 g/mol. Its IUPAC name is 4-[(5E)-5-[(4-methylphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(1,3-thiazol-2-yl)benzenesulfonamide.
| Compound Name | 4-[(5E)-5-[(4-methylphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(1,3-thiazol-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 6364950 |
| Molecular Formula | C20H15N3O3S4 |
| Molecular Weight | 473.63 g/mol |
| Exact Mass | 473.00 |
| IUPAC Name | 4-[(5E)-5-[(4-methylphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(1,3-thiazol-2-yl)benzenesulfonamide |
| SMILES | Cc1ccc(/C=C2/SC(=S)N(c3ccc(S(=O)(=O)Nc4nccs4)cc3)C2=O)cc1 |
| InChI | InChI=1S/C20H15N3O3S4/c1-13-2-4-14(5-3-13)12-17-18(24)23(20(27)29-17)15-6-8-16(9-7-15)30(25,26)22-19-21-10-11-28-19/h2-12H,1H3,(H,21,22)/b17-12+ |
| InChIKey | OUTLVGYJXCIIQR-SFQUDFHCSA-N |
| XLogP | 4.66 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.63 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|