C15H14F2N2O — CID 63649606
2-(4-fluoroanilino)-2-(3-fluoro-4-methylphenyl)acetamide (PubChem CID 63649606) has the molecular formula C15H14F2N2O and a molecular weight of 276.29 g/mol. Its IUPAC name is 2-(4-fluoroanilino)-2-(3-fluoro-4-methylphenyl)acetamide.
| Compound Name | 2-(4-fluoroanilino)-2-(3-fluoro-4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 63649606 |
| Molecular Formula | C15H14F2N2O |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | 2-(4-fluoroanilino)-2-(3-fluoro-4-methylphenyl)acetamide |
| SMILES | Cc1ccc(C(Nc2ccc(F)cc2)C(N)=O)cc1F |
| InChI | InChI=1S/C15H14F2N2O/c1-9-2-3-10(8-13(9)17)14(15(18)20)19-12-6-4-11(16)5-7-12/h2-8,14,19H,1H3,(H2,18,20) |
| InChIKey | VWGIIMVKIWUOEE-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |