C13H27N2OS+ — CID 6364996
2-(methylamino)-1-(1,2,2,3-tetramethylcyclopentyl)ethanol;methylidene(sulfanylidene)azanium (PubChem CID 6364996) has the molecular formula C13H27N2OS+ and a molecular weight of 259.44 g/mol. Its IUPAC name is 2-(methylamino)-1-(1,2,2,3-tetramethylcyclopentyl)ethanol;methylidene(sulfanylidene)azanium.
| Compound Name | 2-(methylamino)-1-(1,2,2,3-tetramethylcyclopentyl)ethanol;methylidene(sulfanylidene)azanium |
|---|---|
| PubChem CID | 6364996 |
| Molecular Formula | C13H27N2OS+ |
| Molecular Weight | 259.44 g/mol |
| Exact Mass | 259.18 |
| IUPAC Name | 2-(methylamino)-1-(1,2,2,3-tetramethylcyclopentyl)ethanol;methylidene(sulfanylidene)azanium |
| SMILES | C=[N+]=S.CNCC(O)C1(C)CCC(C)C1(C)C |
| InChI | InChI=1S/C12H25NO.CH2NS/c1-9-6-7-12(4,11(9,2)3)10(14)8-13-5;1-2-3/h9-10,13-14H,6-8H2,1-5H3;1H2/q;+1 |
| InChIKey | JLCAPDDASNIXPQ-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 46.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.44 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|