3-hydroxy-2,2,3-trimethylbutanoic acid

C7H14O3 — CID 6365026

IUPAC3-hydroxy-2,2,3-trimethylbutanoic acid
SMILESCC(C)(O)C(C)(C)C(=O)O
InChIInChI=1S/C7H14O3/c1-6(2,5(8)9)7(3,4)10/h10H,1-4H3,(H,8,9)
InChIKeyQQGSLRMICCWIHN-UHFFFAOYSA-N
MW146.19 g/mol
LogP0.87
Rot. Bonds2

About 3-hydroxy-2,2,3-trimethylbutanoic acid

3-hydroxy-2,2,3-trimethylbutanoic acid (PubChem CID 6365026) has the molecular formula C7H14O3 and a molecular weight of 146.19 g/mol. Its IUPAC name is 3-hydroxy-2,2,3-trimethylbutanoic acid.

Molecular Properties

Compound Name3-hydroxy-2,2,3-trimethylbutanoic acid
PubChem CID6365026
Molecular FormulaC7H14O3
Molecular Weight146.19 g/mol
Exact Mass146.09
IUPAC Name3-hydroxy-2,2,3-trimethylbutanoic acid
SMILESCC(C)(O)C(C)(C)C(=O)O
InChIInChI=1S/C7H14O3/c1-6(2,5(8)9)7(3,4)10/h10H,1-4H3,(H,8,9)
InChIKeyQQGSLRMICCWIHN-UHFFFAOYSA-N
XLogP0.87
TPSA57.53 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500146.19
LogP ≤ 50.87
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 3-hydroxy-2,2,3-trimethylbutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-hydroxy-2,2,3-trimethylbutanoic acid?
The IUPAC name of 3-hydroxy-2,2,3-trimethylbutanoic acid (CID 6365026) is 3-hydroxy-2,2,3-trimethylbutanoic acid.
What is the SMILES notation for 3-hydroxy-2,2,3-trimethylbutanoic acid?
The canonical SMILES for 3-hydroxy-2,2,3-trimethylbutanoic acid is CC(C)(O)C(C)(C)C(=O)O.
What is the InChIKey of 3-hydroxy-2,2,3-trimethylbutanoic acid?
The InChIKey is QQGSLRMICCWIHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14O3/c1-6(2,5(8)9)7(3,4)10/h10H,1-4H3,(H,8,9).
What are the key properties of 3-hydroxy-2,2,3-trimethylbutanoic acid?
3-hydroxy-2,2,3-trimethylbutanoic acid has a molecular weight of 146.19 g/mol, XLogP of 0.87, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxy-2,2,3-trimethylbutanoic acid is sourced from PubChem (CID 6365026), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).