C9H27O3Si4 — CID 6365044
1,1,5,5,5-Hexamethyl-3-((trimethylsilyl)oxy)trisiloxane (PubChem CID 6365044) has the molecular formula C9H27O3Si4 and a molecular weight of 295.66 g/mol.
| Compound Name | 1,1,5,5,5-Hexamethyl-3-((trimethylsilyl)oxy)trisiloxane |
|---|---|
| PubChem CID | 6365044 |
| Molecular Formula | C9H27O3Si4 |
| Molecular Weight | 295.66 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | — |
| SMILES | C[Si](C)(C)O[Si](O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C9H27O3Si4/c1-14(2,3)10-13(11-15(4,5)6)12-16(7,8)9/h1-9H3 |
| InChIKey | XAASNKQYFKTYTR-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.66 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|