C14H12N2O5 — CID 63650620
4-[(2-hydroxy-5-methoxybenzoyl)amino]pyridine-2-carboxylic acid (PubChem CID 63650620) has the molecular formula C14H12N2O5 and a molecular weight of 288.26 g/mol. Its IUPAC name is 4-[(2-hydroxy-5-methoxybenzoyl)amino]pyridine-2-carboxylic acid.
| Compound Name | 4-[(2-hydroxy-5-methoxybenzoyl)amino]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 63650620 |
| Molecular Formula | C14H12N2O5 |
| Molecular Weight | 288.26 g/mol |
| Exact Mass | 288.07 |
| IUPAC Name | 4-[(2-hydroxy-5-methoxybenzoyl)amino]pyridine-2-carboxylic acid |
| SMILES | COc1ccc(O)c(C(=O)Nc2ccnc(C(=O)O)c2)c1 |
| InChI | InChI=1S/C14H12N2O5/c1-21-9-2-3-12(17)10(7-9)13(18)16-8-4-5-15-11(6-8)14(19)20/h2-7,17H,1H3,(H,19,20)(H,15,16,18) |
| InChIKey | DTYGFCTVSQEPRY-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 108.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.26 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |