(E)-pentadec-9-enoic acid

C15H28O2 — CID 6365140

IUPAC(E)-pentadec-9-enoic acid
SMILESCCCCC/C=C/CCCCCCCC(=O)O
InChIInChI=1S/C15H28O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15(16)17/h6-7H,2-5,8-14H2,1H3,(H,16,17)/b7-6+
InChIKeyDJCQJZKZUCHHAL-VOTSOKGWSA-N
MW240.39 g/mol
LogP4.94
Rot. Bonds12

About (E)-pentadec-9-enoic acid

(E)-pentadec-9-enoic acid (PubChem CID 6365140) has the molecular formula C15H28O2 and a molecular weight of 240.39 g/mol. Its IUPAC name is (E)-pentadec-9-enoic acid.

Molecular Properties

Compound Name(E)-pentadec-9-enoic acid
PubChem CID6365140
Molecular FormulaC15H28O2
Molecular Weight240.39 g/mol
Exact Mass240.21
IUPAC Name(E)-pentadec-9-enoic acid
SMILESCCCCC/C=C/CCCCCCCC(=O)O
InChIInChI=1S/C15H28O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15(16)17/h6-7H,2-5,8-14H2,1H3,(H,16,17)/b7-6+
InChIKeyDJCQJZKZUCHHAL-VOTSOKGWSA-N
XLogP4.94
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds12
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500240.39
LogP ≤ 54.94
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze (E)-pentadec-9-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (E)-pentadec-9-enoic acid?
The IUPAC name of (E)-pentadec-9-enoic acid (CID 6365140) is (E)-pentadec-9-enoic acid.
What is the SMILES notation for (E)-pentadec-9-enoic acid?
The canonical SMILES for (E)-pentadec-9-enoic acid is CCCCC/C=C/CCCCCCCC(=O)O.
What is the InChIKey of (E)-pentadec-9-enoic acid?
The InChIKey is DJCQJZKZUCHHAL-VOTSOKGWSA-N. The full InChI is InChI=1S/C15H28O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15(16)17/h6-7H,2-5,8-14H2,1H3,(H,16,17)/b7-6+.
What are the key properties of (E)-pentadec-9-enoic acid?
(E)-pentadec-9-enoic acid has a molecular weight of 240.39 g/mol, XLogP of 4.94, 12 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-pentadec-9-enoic acid is sourced from PubChem (CID 6365140), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).