About 2-methylpropyl benzenesulfonate
2-methylpropyl benzenesulfonate (PubChem CID 6365182) has the molecular formula C10H14O3S
and a molecular weight of 214.29 g/mol. Its IUPAC name is 2-methylpropyl benzenesulfonate.
Molecular Properties
| Compound Name | 2-methylpropyl benzenesulfonate |
| PubChem CID | 6365182 |
| Molecular Formula | C10H14O3S |
| Molecular Weight | 214.29 g/mol |
| Exact Mass | 214.07 |
| IUPAC Name | 2-methylpropyl benzenesulfonate |
| SMILES | CC(C)COS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C10H14O3S/c1-9(2)8-13-14(11,12)10-6-4-3-5-7-10/h3-7,9H,8H2,1-2H3 |
| InChIKey | NFRRFEFZKGNYKS-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.29 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze 2-methylpropyl benzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropyl benzenesulfonate?
The IUPAC name of 2-methylpropyl benzenesulfonate (CID 6365182) is 2-methylpropyl benzenesulfonate.
What is the SMILES notation for 2-methylpropyl benzenesulfonate?
The canonical SMILES for 2-methylpropyl benzenesulfonate is CC(C)COS(=O)(=O)c1ccccc1.
What is the InChIKey of 2-methylpropyl benzenesulfonate?
The InChIKey is NFRRFEFZKGNYKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O3S/c1-9(2)8-13-14(11,12)10-6-4-3-5-7-10/h3-7,9H,8H2,1-2H3.
What are the key properties of 2-methylpropyl benzenesulfonate?
2-methylpropyl benzenesulfonate has a molecular weight of 214.29 g/mol, XLogP of 2.05, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropyl benzenesulfonate is sourced from PubChem (CID 6365182), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).