About 2-[1,3-benzothiazole-6-carbonyl(carboxymethyl)amino]acetic acid
2-[1,3-benzothiazole-6-carbonyl(carboxymethyl)amino]acetic acid (PubChem CID 63651903) has the molecular formula C12H10N2O5S
and a molecular weight of 294.29 g/mol. Its IUPAC name is 2-[1,3-benzothiazole-6-carbonyl(carboxymethyl)amino]acetic acid.
Molecular Properties
| Compound Name | 2-[1,3-benzothiazole-6-carbonyl(carboxymethyl)amino]acetic acid |
| PubChem CID | 63651903 |
| Molecular Formula | C12H10N2O5S |
| Molecular Weight | 294.29 g/mol |
| Exact Mass | 294.03 |
| IUPAC Name | 2-[1,3-benzothiazole-6-carbonyl(carboxymethyl)amino]acetic acid |
| SMILES | O=C(O)CN(CC(=O)O)C(=O)c1ccc2ncsc2c1 |
| InChI | InChI=1S/C12H10N2O5S/c15-10(16)4-14(5-11(17)18)12(19)7-1-2-8-9(3-7)20-6-13-8/h1-3,6H,4-5H2,(H,15,16)(H,17,18) |
| InChIKey | ULLYYLKWHIXQPZ-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 107.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.29 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[1,3-benzothiazole-6-carbonyl(carboxymethyl)amino]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1,3-benzothiazole-6-carbonyl(carboxymethyl)amino]acetic acid?
The IUPAC name of 2-[1,3-benzothiazole-6-carbonyl(carboxymethyl)amino]acetic acid (CID 63651903) is 2-[1,3-benzothiazole-6-carbonyl(carboxymethyl)amino]acetic acid.
What is the SMILES notation for 2-[1,3-benzothiazole-6-carbonyl(carboxymethyl)amino]acetic acid?
The canonical SMILES for 2-[1,3-benzothiazole-6-carbonyl(carboxymethyl)amino]acetic acid is O=C(O)CN(CC(=O)O)C(=O)c1ccc2ncsc2c1.
What is the InChIKey of 2-[1,3-benzothiazole-6-carbonyl(carboxymethyl)amino]acetic acid?
The InChIKey is ULLYYLKWHIXQPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10N2O5S/c15-10(16)4-14(5-11(17)18)12(19)7-1-2-8-9(3-7)20-6-13-8/h1-3,6H,4-5H2,(H,15,16)(H,17,18).
What are the key properties of 2-[1,3-benzothiazole-6-carbonyl(carboxymethyl)amino]acetic acid?
2-[1,3-benzothiazole-6-carbonyl(carboxymethyl)amino]acetic acid has a molecular weight of 294.29 g/mol, XLogP of 0.91, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1,3-benzothiazole-6-carbonyl(carboxymethyl)amino]acetic acid is sourced from PubChem (CID 63651903), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).