C14H15BrO2S — CID 63651959
1-[2-[(3-bromothiophen-2-yl)methoxy]-4-methylphenyl]ethanol (PubChem CID 63651959) has the molecular formula C14H15BrO2S and a molecular weight of 327.24 g/mol. Its IUPAC name is 1-[2-[(3-bromothiophen-2-yl)methoxy]-4-methylphenyl]ethanol.
| Compound Name | 1-[2-[(3-bromothiophen-2-yl)methoxy]-4-methylphenyl]ethanol |
|---|---|
| PubChem CID | 63651959 |
| Molecular Formula | C14H15BrO2S |
| Molecular Weight | 327.24 g/mol |
| Exact Mass | 326.00 |
| IUPAC Name | 1-[2-[(3-bromothiophen-2-yl)methoxy]-4-methylphenyl]ethanol |
| SMILES | Cc1ccc(C(C)O)c(OCc2sccc2Br)c1 |
| InChI | InChI=1S/C14H15BrO2S/c1-9-3-4-11(10(2)16)13(7-9)17-8-14-12(15)5-6-18-14/h3-7,10,16H,8H2,1-2H3 |
| InChIKey | NUCDZHJSCRSLAC-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.24 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |