C9H18N2O2 — CID 63652681
3-(2-aminoethylamino)cyclohexane-1-carboxylic acid (PubChem CID 63652681) has the molecular formula C9H18N2O2 and a molecular weight of 186.25 g/mol. Its IUPAC name is 3-(2-aminoethylamino)cyclohexane-1-carboxylic acid.
| Compound Name | 3-(2-aminoethylamino)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 63652681 |
| Molecular Formula | C9H18N2O2 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.14 |
| IUPAC Name | 3-(2-aminoethylamino)cyclohexane-1-carboxylic acid |
| SMILES | NCCNC1CCCC(C(=O)O)C1 |
| InChI | InChI=1S/C9H18N2O2/c10-4-5-11-8-3-1-2-7(6-8)9(12)13/h7-8,11H,1-6,10H2,(H,12,13) |
| InChIKey | JGANQLJGHGMSLZ-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |