(2E)-6-hydroxy-2,6-dimethylocta-2,7-dienoic acid

C10H16O3 — CID 6365350

IUPAC(2E)-6-hydroxy-2,6-dimethylocta-2,7-dienoic acid
SMILESC=CC(C)(O)CC/C=C(\C)C(=O)O
InChIInChI=1S/C10H16O3/c1-4-10(3,13)7-5-6-8(2)9(11)12/h4,6,13H,1,5,7H2,2-3H3,(H,11,12)/b8-6+
InChIKeySSKWMOQUUQAJGV-SOFGYWHQSA-N
MW184.23 g/mol
LogP1.73
Rot. Bonds5

About (2E)-6-hydroxy-2,6-dimethylocta-2,7-dienoic acid

(2E)-6-hydroxy-2,6-dimethylocta-2,7-dienoic acid (PubChem CID 6365350) has the molecular formula C10H16O3 and a molecular weight of 184.23 g/mol. Its IUPAC name is (2E)-6-hydroxy-2,6-dimethylocta-2,7-dienoic acid.

Molecular Properties

Compound Name(2E)-6-hydroxy-2,6-dimethylocta-2,7-dienoic acid
PubChem CID6365350
Molecular FormulaC10H16O3
Molecular Weight184.23 g/mol
Exact Mass184.11
IUPAC Name(2E)-6-hydroxy-2,6-dimethylocta-2,7-dienoic acid
SMILESC=CC(C)(O)CC/C=C(\C)C(=O)O
InChIInChI=1S/C10H16O3/c1-4-10(3,13)7-5-6-8(2)9(11)12/h4,6,13H,1,5,7H2,2-3H3,(H,11,12)/b8-6+
InChIKeySSKWMOQUUQAJGV-SOFGYWHQSA-N
XLogP1.73
TPSA57.53 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500184.23
LogP ≤ 51.73
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze (2E)-6-hydroxy-2,6-dimethylocta-2,7-dienoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2E)-6-hydroxy-2,6-dimethylocta-2,7-dienoic acid?
The IUPAC name of (2E)-6-hydroxy-2,6-dimethylocta-2,7-dienoic acid (CID 6365350) is (2E)-6-hydroxy-2,6-dimethylocta-2,7-dienoic acid.
What is the SMILES notation for (2E)-6-hydroxy-2,6-dimethylocta-2,7-dienoic acid?
The canonical SMILES for (2E)-6-hydroxy-2,6-dimethylocta-2,7-dienoic acid is C=CC(C)(O)CC/C=C(\C)C(=O)O.
What is the InChIKey of (2E)-6-hydroxy-2,6-dimethylocta-2,7-dienoic acid?
The InChIKey is SSKWMOQUUQAJGV-SOFGYWHQSA-N. The full InChI is InChI=1S/C10H16O3/c1-4-10(3,13)7-5-6-8(2)9(11)12/h4,6,13H,1,5,7H2,2-3H3,(H,11,12)/b8-6+.
What are the key properties of (2E)-6-hydroxy-2,6-dimethylocta-2,7-dienoic acid?
(2E)-6-hydroxy-2,6-dimethylocta-2,7-dienoic acid has a molecular weight of 184.23 g/mol, XLogP of 1.73, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-6-hydroxy-2,6-dimethylocta-2,7-dienoic acid is sourced from PubChem (CID 6365350), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).