About N-(6-amino-3-pyridinyl)-1H-1,2,4-triazole-5-carboxamide
N-(6-amino-3-pyridinyl)-1H-1,2,4-triazole-5-carboxamide (PubChem CID 63653831) has the molecular formula C8H8N6O
and a molecular weight of 204.19 g/mol. Its IUPAC name is N-(6-amino-3-pyridinyl)-1H-1,2,4-triazole-5-carboxamide.
Molecular Properties
| Compound Name | N-(6-amino-3-pyridinyl)-1H-1,2,4-triazole-5-carboxamide |
| PubChem CID | 63653831 |
| Molecular Formula | C8H8N6O |
| Molecular Weight | 204.19 g/mol |
| Exact Mass | 204.08 |
| IUPAC Name | N-(6-amino-3-pyridinyl)-1H-1,2,4-triazole-5-carboxamide |
| SMILES | Nc1ccc(NC(=O)c2ncn[nH]2)cn1 |
| InChI | InChI=1S/C8H8N6O/c9-6-2-1-5(3-10-6)13-8(15)7-11-4-12-14-7/h1-4H,(H2,9,10)(H,13,15)(H,11,12,14) |
| InChIKey | KFEKMGIBLHVUJU-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 109.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.19 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-(6-amino-3-pyridinyl)-1H-1,2,4-triazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(6-amino-3-pyridinyl)-1H-1,2,4-triazole-5-carboxamide?
The IUPAC name of N-(6-amino-3-pyridinyl)-1H-1,2,4-triazole-5-carboxamide (CID 63653831) is N-(6-amino-3-pyridinyl)-1H-1,2,4-triazole-5-carboxamide.
What is the SMILES notation for N-(6-amino-3-pyridinyl)-1H-1,2,4-triazole-5-carboxamide?
The canonical SMILES for N-(6-amino-3-pyridinyl)-1H-1,2,4-triazole-5-carboxamide is Nc1ccc(NC(=O)c2ncn[nH]2)cn1.
What is the InChIKey of N-(6-amino-3-pyridinyl)-1H-1,2,4-triazole-5-carboxamide?
The InChIKey is KFEKMGIBLHVUJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N6O/c9-6-2-1-5(3-10-6)13-8(15)7-11-4-12-14-7/h1-4H,(H2,9,10)(H,13,15)(H,11,12,14).
What are the key properties of N-(6-amino-3-pyridinyl)-1H-1,2,4-triazole-5-carboxamide?
N-(6-amino-3-pyridinyl)-1H-1,2,4-triazole-5-carboxamide has a molecular weight of 204.19 g/mol, XLogP of 0.03, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(6-amino-3-pyridinyl)-1H-1,2,4-triazole-5-carboxamide is sourced from PubChem (CID 63653831), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).