C17H20BrNO2 — CID 63653949
[2-[2-amino-1-(3-bromophenyl)butoxy]phenyl]methanol (PubChem CID 63653949) has the molecular formula C17H20BrNO2 and a molecular weight of 350.26 g/mol. Its IUPAC name is [2-[2-amino-1-(3-bromophenyl)butoxy]phenyl]methanol.
| Compound Name | [2-[2-amino-1-(3-bromophenyl)butoxy]phenyl]methanol |
|---|---|
| PubChem CID | 63653949 |
| Molecular Formula | C17H20BrNO2 |
| Molecular Weight | 350.26 g/mol |
| Exact Mass | 349.07 |
| IUPAC Name | [2-[2-amino-1-(3-bromophenyl)butoxy]phenyl]methanol |
| SMILES | CCC(N)C(Oc1ccccc1CO)c1cccc(Br)c1 |
| InChI | InChI=1S/C17H20BrNO2/c1-2-15(19)17(12-7-5-8-14(18)10-12)21-16-9-4-3-6-13(16)11-20/h3-10,15,17,20H,2,11,19H2,1H3 |
| InChIKey | ZYHGKQCJVQNXLM-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.26 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |