About (E)-N,N-diethyl-3,7-dimethyloct-2-en-1-amine
(E)-N,N-diethyl-3,7-dimethyloct-2-en-1-amine (PubChem CID 6365440) has the molecular formula C14H29N
and a molecular weight of 211.39 g/mol. Its IUPAC name is (E)-N,N-diethyl-3,7-dimethyloct-2-en-1-amine.
Molecular Properties
| Compound Name | (E)-N,N-diethyl-3,7-dimethyloct-2-en-1-amine |
| PubChem CID | 6365440 |
| Molecular Formula | C14H29N |
| Molecular Weight | 211.39 g/mol |
| Exact Mass | 211.23 |
| IUPAC Name | (E)-N,N-diethyl-3,7-dimethyloct-2-en-1-amine |
| SMILES | CCN(CC)C/C=C(\C)CCCC(C)C |
| InChI | InChI=1S/C14H29N/c1-6-15(7-2)12-11-14(5)10-8-9-13(3)4/h11,13H,6-10,12H2,1-5H3/b14-11+ |
| InChIKey | SWXVCCTXGINQIB-SDNWHVSQSA-N |
| XLogP | 4.10 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.39 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-N,N-diethyl-3,7-dimethyloct-2-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-N,N-diethyl-3,7-dimethyloct-2-en-1-amine?
The IUPAC name of (E)-N,N-diethyl-3,7-dimethyloct-2-en-1-amine (CID 6365440) is (E)-N,N-diethyl-3,7-dimethyloct-2-en-1-amine.
What is the SMILES notation for (E)-N,N-diethyl-3,7-dimethyloct-2-en-1-amine?
The canonical SMILES for (E)-N,N-diethyl-3,7-dimethyloct-2-en-1-amine is CCN(CC)C/C=C(\C)CCCC(C)C.
What is the InChIKey of (E)-N,N-diethyl-3,7-dimethyloct-2-en-1-amine?
The InChIKey is SWXVCCTXGINQIB-SDNWHVSQSA-N. The full InChI is InChI=1S/C14H29N/c1-6-15(7-2)12-11-14(5)10-8-9-13(3)4/h11,13H,6-10,12H2,1-5H3/b14-11+.
What are the key properties of (E)-N,N-diethyl-3,7-dimethyloct-2-en-1-amine?
(E)-N,N-diethyl-3,7-dimethyloct-2-en-1-amine has a molecular weight of 211.39 g/mol, XLogP of 4.10, 8 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-N,N-diethyl-3,7-dimethyloct-2-en-1-amine is sourced from PubChem (CID 6365440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).