5-[(2-hydroxybenzoyl)amino]-2-methylbenzoic acid

C15H13NO4 — CID 63654708

IUPAC5-[(2-hydroxybenzoyl)amino]-2-methylbenzoic acid
SMILESCc1ccc(NC(=O)c2ccccc2O)cc1C(=O)O
InChIInChI=1S/C15H13NO4/c1-9-6-7-10(8-12(9)15(19)20)16-14(18)11-4-2-3-5-13(11)17/h2-8,17H,1H3,(H,16,18)(H,19,20)
InChIKeyIXFMERINFPZUTM-UHFFFAOYSA-N
MW271.27 g/mol
LogP2.65
Rot. Bonds3

About 5-[(2-hydroxybenzoyl)amino]-2-methylbenzoic acid

5-[(2-hydroxybenzoyl)amino]-2-methylbenzoic acid (PubChem CID 63654708) has the molecular formula C15H13NO4 and a molecular weight of 271.27 g/mol. Its IUPAC name is 5-[(2-hydroxybenzoyl)amino]-2-methylbenzoic acid.

Molecular Properties

Compound Name5-[(2-hydroxybenzoyl)amino]-2-methylbenzoic acid
PubChem CID63654708
Molecular FormulaC15H13NO4
Molecular Weight271.27 g/mol
Exact Mass271.08
IUPAC Name5-[(2-hydroxybenzoyl)amino]-2-methylbenzoic acid
SMILESCc1ccc(NC(=O)c2ccccc2O)cc1C(=O)O
InChIInChI=1S/C15H13NO4/c1-9-6-7-10(8-12(9)15(19)20)16-14(18)11-4-2-3-5-13(11)17/h2-8,17H,1H3,(H,16,18)(H,19,20)
InChIKeyIXFMERINFPZUTM-UHFFFAOYSA-N
XLogP2.65
TPSA86.63 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms20
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500271.27
LogP ≤ 52.65
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Analyze 5-[(2-hydroxybenzoyl)amino]-2-methylbenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

5-[(5-chloro-2-hydroxybenzoyl)amino]-2-methylbenzoic acid
CID 63653834
5-[(2,5-dimethylbenzoyl)amino]-2-methylbenzoic acid
CID 63653663
5-[(5-chloro-2-methylbenzoyl)amino]-2-methylbenzoic acid
CID 82877012
5-[(2,5-dimethylthiophene-3-carbonyl)amino]-2-methylbenzoic acid
CID 63654176
5-[(5-fluoro-2-methylbenzoyl)amino]-2-methylbenzoic acid
CID 63652796
2-methyl-5-[(4-methylthiophene-3-carbonyl)amino]benzoic acid
CID 79802864
2-hydroxy-5-[(2-iodobenzoyl)amino]benzoic acid
CID 16773138
5-[(2,3-dihydroxybenzoyl)amino]-2-hydroxybenzoic acid
CID 114343235
ethane;2-hydroxy-N-phenylbenzamide
CID 54170056
5-[(2,5-dichlorobenzoyl)amino]-2-methylbenzoic acid
CID 63653152
2-hydroxy-N-phenylbenzamide
CID 157209959
N-[4-hydroxy-3-[(2-methylbenzoyl)amino]phenyl]-2-methylbenzamide
CID 154278124

Frequently Asked Questions

What is the IUPAC name of 5-[(2-hydroxybenzoyl)amino]-2-methylbenzoic acid?
The IUPAC name of 5-[(2-hydroxybenzoyl)amino]-2-methylbenzoic acid (CID 63654708) is 5-[(2-hydroxybenzoyl)amino]-2-methylbenzoic acid.
What is the SMILES notation for 5-[(2-hydroxybenzoyl)amino]-2-methylbenzoic acid?
The canonical SMILES for 5-[(2-hydroxybenzoyl)amino]-2-methylbenzoic acid is Cc1ccc(NC(=O)c2ccccc2O)cc1C(=O)O.
What is the InChIKey of 5-[(2-hydroxybenzoyl)amino]-2-methylbenzoic acid?
The InChIKey is IXFMERINFPZUTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13NO4/c1-9-6-7-10(8-12(9)15(19)20)16-14(18)11-4-2-3-5-13(11)17/h2-8,17H,1H3,(H,16,18)(H,19,20).
What are the key properties of 5-[(2-hydroxybenzoyl)amino]-2-methylbenzoic acid?
5-[(2-hydroxybenzoyl)amino]-2-methylbenzoic acid has a molecular weight of 271.27 g/mol, XLogP of 2.65, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(2-hydroxybenzoyl)amino]-2-methylbenzoic acid is sourced from PubChem (CID 63654708), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).