C11H10N2O2S — CID 63654743
2-methyl-5-(1,3-thiazol-2-ylamino)benzoic acid (PubChem CID 63654743) has the molecular formula C11H10N2O2S and a molecular weight of 234.28 g/mol. Its IUPAC name is 2-methyl-5-(1,3-thiazol-2-ylamino)benzoic acid.
| Compound Name | 2-methyl-5-(1,3-thiazol-2-ylamino)benzoic acid |
|---|---|
| PubChem CID | 63654743 |
| Molecular Formula | C11H10N2O2S |
| Molecular Weight | 234.28 g/mol |
| Exact Mass | 234.05 |
| IUPAC Name | 2-methyl-5-(1,3-thiazol-2-ylamino)benzoic acid |
| SMILES | Cc1ccc(Nc2nccs2)cc1C(=O)O |
| InChI | InChI=1S/C11H10N2O2S/c1-7-2-3-8(6-9(7)10(14)15)13-11-12-4-5-16-11/h2-6H,1H3,(H,12,13)(H,14,15) |
| InChIKey | JKQCUAHXYQBQRG-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.28 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |