C13H11N3O4 — CID 63654787
2-[(2-methoxypyridine-3-carbonyl)amino]pyridine-3-carboxylic acid (PubChem CID 63654787) has the molecular formula C13H11N3O4 and a molecular weight of 273.25 g/mol. Its IUPAC name is 2-[(2-methoxypyridine-3-carbonyl)amino]pyridine-3-carboxylic acid.
| Compound Name | 2-[(2-methoxypyridine-3-carbonyl)amino]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 63654787 |
| Molecular Formula | C13H11N3O4 |
| Molecular Weight | 273.25 g/mol |
| Exact Mass | 273.07 |
| IUPAC Name | 2-[(2-methoxypyridine-3-carbonyl)amino]pyridine-3-carboxylic acid |
| SMILES | COc1ncccc1C(=O)Nc1ncccc1C(=O)O |
| InChI | InChI=1S/C13H11N3O4/c1-20-12-9(5-3-7-15-12)11(17)16-10-8(13(18)19)4-2-6-14-10/h2-7H,1H3,(H,18,19)(H,14,16,17) |
| InChIKey | SQXSDOJLFDLBGR-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 101.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.25 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |