About 2-but-3-ynoxy-1,3,5-trichlorobenzene
2-but-3-ynoxy-1,3,5-trichlorobenzene (PubChem CID 63655420) has the molecular formula C10H7Cl3O
and a molecular weight of 249.52 g/mol. Its IUPAC name is 2-but-3-ynoxy-1,3,5-trichlorobenzene.
Molecular Properties
| Compound Name | 2-but-3-ynoxy-1,3,5-trichlorobenzene |
| PubChem CID | 63655420 |
| Molecular Formula | C10H7Cl3O |
| Molecular Weight | 249.52 g/mol |
| Exact Mass | 247.96 |
| IUPAC Name | 2-but-3-ynoxy-1,3,5-trichlorobenzene |
| SMILES | C#CCCOc1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C10H7Cl3O/c1-2-3-4-14-10-8(12)5-7(11)6-9(10)13/h1,5-6H,3-4H2 |
| InChIKey | PWTVGSRAWGOXEV-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.52 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-but-3-ynoxy-1,3,5-trichlorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-but-3-ynoxy-1,3,5-trichlorobenzene?
The IUPAC name of 2-but-3-ynoxy-1,3,5-trichlorobenzene (CID 63655420) is 2-but-3-ynoxy-1,3,5-trichlorobenzene.
What is the SMILES notation for 2-but-3-ynoxy-1,3,5-trichlorobenzene?
The canonical SMILES for 2-but-3-ynoxy-1,3,5-trichlorobenzene is C#CCCOc1c(Cl)cc(Cl)cc1Cl.
What is the InChIKey of 2-but-3-ynoxy-1,3,5-trichlorobenzene?
The InChIKey is PWTVGSRAWGOXEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7Cl3O/c1-2-3-4-14-10-8(12)5-7(11)6-9(10)13/h1,5-6H,3-4H2.
What are the key properties of 2-but-3-ynoxy-1,3,5-trichlorobenzene?
2-but-3-ynoxy-1,3,5-trichlorobenzene has a molecular weight of 249.52 g/mol, XLogP of 4.05, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-but-3-ynoxy-1,3,5-trichlorobenzene is sourced from PubChem (CID 63655420), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).