C13H28N2 — CID 63655712
N'-(cyclopentylmethyl)-N,N'-dimethylpentane-1,5-diamine (PubChem CID 63655712) has the molecular formula C13H28N2 and a molecular weight of 212.38 g/mol. Its IUPAC name is N'-(cyclopentylmethyl)-N,N'-dimethylpentane-1,5-diamine.
| Compound Name | N'-(cyclopentylmethyl)-N,N'-dimethylpentane-1,5-diamine |
|---|---|
| PubChem CID | 63655712 |
| Molecular Formula | C13H28N2 |
| Molecular Weight | 212.38 g/mol |
| Exact Mass | 212.23 |
| IUPAC Name | N'-(cyclopentylmethyl)-N,N'-dimethylpentane-1,5-diamine |
| SMILES | CNCCCCCN(C)CC1CCCC1 |
| InChI | InChI=1S/C13H28N2/c1-14-10-6-3-7-11-15(2)12-13-8-4-5-9-13/h13-14H,3-12H2,1-2H3 |
| InChIKey | OYLAHOBTZNGVJG-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.38 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|