About (5E)-undeca-1,5-dien-4-ol
(5E)-undeca-1,5-dien-4-ol (PubChem CID 6365607) has the molecular formula C11H20O
and a molecular weight of 168.28 g/mol. Its IUPAC name is (5E)-undeca-1,5-dien-4-ol.
Molecular Properties
| Compound Name | (5E)-undeca-1,5-dien-4-ol |
| PubChem CID | 6365607 |
| Molecular Formula | C11H20O |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.15 |
| IUPAC Name | (5E)-undeca-1,5-dien-4-ol |
| SMILES | C=CCC(O)/C=C/CCCCC |
| InChI | InChI=1S/C11H20O/c1-3-5-6-7-8-10-11(12)9-4-2/h4,8,10-12H,2-3,5-7,9H2,1H3/b10-8+ |
| InChIKey | XPHXCGYGEZUXRT-CSKARUKUSA-N |
| XLogP | 3.06 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (5E)-undeca-1,5-dien-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5E)-undeca-1,5-dien-4-ol?
The IUPAC name of (5E)-undeca-1,5-dien-4-ol (CID 6365607) is (5E)-undeca-1,5-dien-4-ol.
What is the SMILES notation for (5E)-undeca-1,5-dien-4-ol?
The canonical SMILES for (5E)-undeca-1,5-dien-4-ol is C=CCC(O)/C=C/CCCCC.
What is the InChIKey of (5E)-undeca-1,5-dien-4-ol?
The InChIKey is XPHXCGYGEZUXRT-CSKARUKUSA-N. The full InChI is InChI=1S/C11H20O/c1-3-5-6-7-8-10-11(12)9-4-2/h4,8,10-12H,2-3,5-7,9H2,1H3/b10-8+.
What are the key properties of (5E)-undeca-1,5-dien-4-ol?
(5E)-undeca-1,5-dien-4-ol has a molecular weight of 168.28 g/mol, XLogP of 3.06, 7 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (5E)-undeca-1,5-dien-4-ol is sourced from PubChem (CID 6365607), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).